CAS 86241-47-6 is the registry number for 1,3-Dichloro-5-(trichloromethyl)benzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
1,3-dichloro-5-(trichloromethyl)benzene (CAS 86241-47-6) is a chemical compound with the molecular formula C7H3Cl5 and a molecular weight of 264.4 g/mol. IUPAC name: 1,3-dichloro-5-(trichloromethyl)benzene. InChIKey: DHTRCEKKRKYZSP-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl5 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 1,3-dichloro-5-(trichloromethyl)benzene |
| InChIKey | DHTRCEKKRKYZSP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)