Products 847259-88-5

CAS 847259-88-5 is the registry number for tert-Butyl N-((2R)-2-azidopropyl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(2R)-2-azidopropyl]carbamate (CAS 847259-88-5) is a chemical compound with the molecular formula C8H16N4O2 and a molecular weight of 200.24 g/mol. IUPAC name: tert-butyl N-[(2R)-2-azidopropyl]carbamate. InChIKey: FDOYGAKJURINKV-ZCFIWIBFSA-N.

Identity
Molecular formulaC8H16N4O2
Molecular weight200.24 g/mol
IUPAC nametert-butyl N-[(2R)-2-azidopropyl]carbamate
InChIKeyFDOYGAKJURINKV-ZCFIWIBFSA-N
SMILESC[C@H](CNC(=O)OC(C)(C)C)N=[N+]=[N-]

Computed by PubChem (NCBI)