CAS 847259-90-9 is the registry number for tert-Butyl (2-azidoethyl)(methyl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Tert-butyl N-(2-azidoethyl)-N-methylcarbamate (CAS 847259-90-9) is a chemical compound with the molecular formula C8H16N4O2 and a molecular weight of 200.24 g/mol. IUPAC name: tert-butyl N-(2-azidoethyl)-N-methylcarbamate. InChIKey: HBIZLVGJYYDTIS-UHFFFAOYSA-N.
| Molecular formula | C8H16N4O2 |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | tert-butyl N-(2-azidoethyl)-N-methylcarbamate |
| InChIKey | HBIZLVGJYYDTIS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)CCN=[N+]=[N-] |
Computed by PubChem (NCBI)