CAS 847416-51-7 appears in our catalog under these names: 3-(2-tert-butoxy-2-oxo-ethylidene)cyclobutanecarboxylic acid, 97%, 97%, 3-[2-(TERT-BUTOXY)-2-OXOETHYLIDENE]CYCLOBUTANE-1-CARBOXYLIC ACID, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]cyclobutane-1-carboxylic acid (CAS 847416-51-7) is a chemical compound with the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. IUPAC name: 3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]cyclobutane-1-carboxylic acid. InChIKey: NXVQBHKRTUAEBN-UHFFFAOYSA-N.
| Molecular formula | C11H16O4 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]cyclobutane-1-carboxylic acid |
| InChIKey | NXVQBHKRTUAEBN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C=C1CC(C1)C(=O)O |
Computed by PubChem (NCBI)