CAS 84752-20-5 appears in our catalog under these names: 5–Bromo–3–nitrobenzene–1,2–diamine, 5-Bromo-3-nitrobenzene-1,2-diamine, 95%, 5-Bromo-3-nitrobenzene-1,2-diamine, 95%, 95%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g, 10g.
5-bromo-3-nitrobenzene-1,2-diamine (CAS 84752-20-5) is a chemical compound with the molecular formula C6H6BrN3O2 and a molecular weight of 232.03 g/mol. IUPAC name: 5-bromo-3-nitrobenzene-1,2-diamine. InChIKey: FBPCXPVYWUQREV-UHFFFAOYSA-N.
| Molecular formula | C6H6BrN3O2 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 5-bromo-3-nitrobenzene-1,2-diamine |
| InChIKey | FBPCXPVYWUQREV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)N)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)