Products 84845-57-8
CAS 84845-57-8 is the registry number for Ritipenem. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 5mg, 50mg, Get quote.
(5R,6S)-3-(carbamoyloxymethyl)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (CAS 84845-57-8) is a chemical compound with the molecular formula C10H12N2O6S and a molecular weight of 288.28 g/mol. IUPAC name: (5R,6S)-3-(carbamoyloxymethyl)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid. InChIKey: IKQNRQOUOZJHTR-UWBRJAPDSA-N.
| Molecular formula | C10H12N2O6S |
|---|---|
| Molecular weight | 288.28 g/mol |
| IUPAC name | (5R,6S)-3-(carbamoyloxymethyl)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| InChIKey | IKQNRQOUOZJHTR-UWBRJAPDSA-N |
| SMILES | C[C@H]([C@@H]1[C@@H]2N(C1=O)C(=C(S2)COC(=O)N)C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Ritipenem, ritipenemum, Ritipenem [INN], fce22101, Ritipenem (sodium), RITIPENEM [MI], orb2814926