CAS 848565-90-2 is the registry number for Diethyl 2-Ethyl-2-methylmalonate-D3. Offered by: TRC. Available pack sizes: 100mg.
Diethyl 2-ethyl-2-(trideuteriomethyl)propanedioate (CAS 848565-90-2) is a chemical compound with the molecular formula C10H18O4 and a molecular weight of 205.27 g/mol. IUPAC name: diethyl 2-ethyl-2-(trideuteriomethyl)propanedioate. InChIKey: ODRGILDUWDVBJX-GKOSEXJESA-N.
| Molecular formula | C10H18O4 |
|---|---|
| Molecular weight | 205.27 g/mol |
| IUPAC name | diethyl 2-ethyl-2-(trideuteriomethyl)propanedioate |
| InChIKey | ODRGILDUWDVBJX-GKOSEXJESA-N |
| SMILES | [2H]C([2H])([2H])C(CC)(C(=O)OCC)C(=O)OCC |
Computed by PubChem (NCBI)