CAS 848652-09-5 is the registry number for 5,6-Dimethoxy-3'-trifluoromethyl-2-cyano-biphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g.
3,4-dimethoxy-2-[3-(trifluoromethyl)phenyl]benzonitrile (CAS 848652-09-5) is a chemical compound with the molecular formula C16H12F3NO2 and a molecular weight of 307.27 g/mol. IUPAC name: 3,4-dimethoxy-2-[3-(trifluoromethyl)phenyl]benzonitrile. InChIKey: YYZHMFQIJQVGQY-UHFFFAOYSA-N.
| Molecular formula | C16H12F3NO2 |
|---|---|
| Molecular weight | 307.27 g/mol |
| IUPAC name | 3,4-dimethoxy-2-[3-(trifluoromethyl)phenyl]benzonitrile |
| InChIKey | YYZHMFQIJQVGQY-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C#N)C2=CC(=CC=C2)C(F)(F)F)OC |
Computed by PubChem (NCBI)