Products 876759-97-6
CAS 876759-97-6 is the registry number for AR antagonist 7. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(2-methoxy-4-methylphenoxy)-2-(trifluoromethyl)benzonitrile (CAS 876759-97-6) is a chemical compound with the molecular formula C16H12F3NO2 and a molecular weight of 307.27 g/mol. IUPAC name: 4-(2-methoxy-4-methylphenoxy)-2-(trifluoromethyl)benzonitrile. InChIKey: CYANSKHXCRJRPW-UHFFFAOYSA-N.
| Molecular formula | C16H12F3NO2 |
|---|---|
| Molecular weight | 307.27 g/mol |
| IUPAC name | 4-(2-methoxy-4-methylphenoxy)-2-(trifluoromethyl)benzonitrile |
| InChIKey | CYANSKHXCRJRPW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC2=CC(=C(C=C2)C#N)C(F)(F)F)OC |
Computed by PubChem (NCBI)