CAS 848696-72-0 is the registry number for 1-(Bromomethyl)-2-chloro-3,4-dimethoxybenzene. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(bromomethyl)-2-chloro-3,4-dimethoxybenzene (CAS 848696-72-0) is a chemical compound with the molecular formula C9H10BrClO2 and a molecular weight of 265.53 g/mol. IUPAC name: 1-(bromomethyl)-2-chloro-3,4-dimethoxybenzene. InChIKey: FSKSHIWXDFHKQF-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClO2 |
|---|---|
| Molecular weight | 265.53 g/mol |
| IUPAC name | 1-(bromomethyl)-2-chloro-3,4-dimethoxybenzene |
| InChIKey | FSKSHIWXDFHKQF-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CBr)Cl)OC |
Computed by PubChem (NCBI)