CAS 848853-75-8 is the registry number for 4-(4-BOC-aminophenyl)phenol, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-[4-(4-hydroxyphenyl)phenyl]carbamate (CAS 848853-75-8) is a chemical compound with the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. IUPAC name: tert-butyl N-[4-(4-hydroxyphenyl)phenyl]carbamate. InChIKey: IJZZTPIOYKYBOI-UHFFFAOYSA-N.
| Molecular formula | C17H19NO3 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | tert-butyl N-[4-(4-hydroxyphenyl)phenyl]carbamate |
| InChIKey | IJZZTPIOYKYBOI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)