Products 849035-91-2
CAS 849035-91-2 is the registry number for 1-Boc-4-[4-(methylsulfonyl)-2-nitrophenyl]piperidin-4-amine, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
Tert-butyl 4-amino-4-(4-methylsulfonyl-2-nitrophenyl)piperidine-1-carboxylate (CAS 849035-91-2) is a chemical compound with the molecular formula C17H25N3O6S and a molecular weight of 399.5 g/mol. IUPAC name: tert-butyl 4-amino-4-(4-methylsulfonyl-2-nitrophenyl)piperidine-1-carboxylate. InChIKey: TZGQSNRENCNEOD-UHFFFAOYSA-N.
| Molecular formula | C17H25N3O6S |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | tert-butyl 4-amino-4-(4-methylsulfonyl-2-nitrophenyl)piperidine-1-carboxylate |
| InChIKey | TZGQSNRENCNEOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C2=C(C=C(C=C2)S(=O)(=O)C)[N+](=O)[O-])N |
Computed by PubChem (NCBI)