CAS 949109-36-8 is the registry number for (S)–tert–Butyl 3–methyl–4–((2–nitrophenyl)sulfonyl)–1,4–diazepane–1–carboxylate. Offered by: GLPBio. Available pack sizes: 1g.
Tert-butyl (3S)-3-methyl-4-(2-nitrophenyl)sulfonyl-1,4-diazepane-1-carboxylate (CAS 949109-36-8) is a chemical compound with the molecular formula C17H25N3O6S and a molecular weight of 399.5 g/mol. IUPAC name: tert-butyl (3S)-3-methyl-4-(2-nitrophenyl)sulfonyl-1,4-diazepane-1-carboxylate. InChIKey: ZIFXYEQQDVXSEN-ZDUSSCGKSA-N.
| Molecular formula | C17H25N3O6S |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | tert-butyl (3S)-3-methyl-4-(2-nitrophenyl)sulfonyl-1,4-diazepane-1-carboxylate |
| InChIKey | ZIFXYEQQDVXSEN-ZDUSSCGKSA-N |
| SMILES | C[C@H]1CN(CCCN1S(=O)(=O)C2=CC=CC=C2[N+](=O)[O-])C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)