CAS 849052-15-9 appears in our catalog under these names: 4-(2'-Chlorobenzyloxy)-3,5-dimethylphenylboronic acid, 95%, (4-((2-Chlorobenzyl)oxy)-3,5-dimethylphenyl)boronic acid 95%, 4-(2'-Chlorobenzyloxy)-3,5-dimethylphenylboronic acid, 95%, 95%, (4-((2-Chlorobenzyl)oxy)-3,5-dimethylphenyl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
[4-[(2-chlorophenyl)methoxy]-3,5-dimethylphenyl]boronic acid (CAS 849052-15-9) is a chemical compound with the molecular formula C15H16BClO3 and a molecular weight of 290.5 g/mol. IUPAC name: [4-[(2-chlorophenyl)methoxy]-3,5-dimethylphenyl]boronic acid. InChIKey: UDKYOMYSPIEDTK-UHFFFAOYSA-N.
| Molecular formula | C15H16BClO3 |
|---|---|
| Molecular weight | 290.5 g/mol |
| IUPAC name | [4-[(2-chlorophenyl)methoxy]-3,5-dimethylphenyl]boronic acid |
| InChIKey | UDKYOMYSPIEDTK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)OCC2=CC=CC=C2Cl)C)(O)O |
Computed by PubChem (NCBI)