Products 849062-21-1

CAS 849062-21-1 appears in our catalog under these names: 4-(3'-Chlorobenzyloxy)-3,5-dimethylphenylboronic acid, 95%, (4-((3-Chlorobenzyl)oxy)-3,5-dimethylphenyl)boronic acid 95%, 4-(3'-CHLOROBENZYLOXY)-3,5-DIMETHYLPHENYLBORONIC ACID, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

[4-[(3-chlorophenyl)methoxy]-3,5-dimethylphenyl]boronic acid (CAS 849062-21-1) is a chemical compound with the molecular formula C15H16BClO3 and a molecular weight of 290.5 g/mol. IUPAC name: [4-[(3-chlorophenyl)methoxy]-3,5-dimethylphenyl]boronic acid. InChIKey: FSGQMHRYHYNMCX-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16BClO3
Molecular weight290.5 g/mol
IUPAC name[4-[(3-chlorophenyl)methoxy]-3,5-dimethylphenyl]boronic acid
InChIKeyFSGQMHRYHYNMCX-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1)C)OCC2=CC(=CC=C2)Cl)C)(O)O

Computed by PubChem (NCBI)