Products 849669-54-1
CAS 849669-54-1 appears in our catalog under these names: AQX–016A, AQX-016a, AQX-016A, 99.51%, AQX-016A, 98%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 25mg, 5mg, 50mg, 25 mg, 5 mg, 10 mg, 1mg.
(6aR,11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluorene-9,10-diol (CAS 849669-54-1) is a chemical compound with the molecular formula C22H32O2 and a molecular weight of 328.5 g/mol. IUPAC name: (6aR,11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluorene-9,10-diol. InChIKey: DTFQQAANPRPMBC-CZVICOMLSA-N.
| Molecular formula | C22H32O2 |
|---|---|
| Molecular weight | 328.5 g/mol |
| IUPAC name | (6aR,11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluorene-9,10-diol |
| InChIKey | DTFQQAANPRPMBC-CZVICOMLSA-N |
| SMILES | CC1=CC(=C(C2=C1[C@@]3(CCC4[C@@]([C@H]3C2)(CCCC4(C)C)C)C)O)O |
Computed by PubChem (NCBI)