CAS 849833-62-1 is the registry number for (Z)-N',2-Dihydroxybenzimidamide, 98%. Offered by: AmBeed. Available pack sizes: 25g.
N',2-dihydroxybenzenecarboximidamide (CAS 849833-62-1) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: N',2-dihydroxybenzenecarboximidamide. InChIKey: DVAPQSJNIZTABV-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | N',2-dihydroxybenzenecarboximidamide |
| InChIKey | DVAPQSJNIZTABV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)/C(=N/O)/N)O |
Computed by PubChem (NCBI)