Products 850180-76-6
CAS 850180-76-6 appears in our catalog under these names: N3-C2-NHS ester, N3–C2–NHS ester, 3-Azidopropanoate-N-hydroxysuccinimide ester, N3-C2-NHS ester, 99.77%, (2,5-Dioxopyrrolidin-1-yl) 3-azidopropanoate, 98%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 1g, 100mg, 500mg, 25mg, 50mg.
(2,5-dioxopyrrolidin-1-yl) 3-azidopropanoate (CAS 850180-76-6) is a chemical compound with the molecular formula C7H8N4O4 and a molecular weight of 212.16 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-azidopropanoate. InChIKey: WATICTZQAVLEKN-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O4 |
|---|---|
| Molecular weight | 212.16 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-azidopropanoate |
| InChIKey | WATICTZQAVLEKN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCN=[N+]=[N-] |
Computed by PubChem (NCBI)