CAS 850180-82-4 is the registry number for 3-Bromo-2,4-dichloro-5-nitropyridine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-bromo-2,4-dichloro-5-nitropyridine (CAS 850180-82-4) is a chemical compound with the molecular formula C5HBrCl2N2O2 and a molecular weight of 271.88 g/mol. IUPAC name: 3-bromo-2,4-dichloro-5-nitropyridine. InChIKey: WQVDZYQKROCNIZ-UHFFFAOYSA-N.
| Molecular formula | C5HBrCl2N2O2 |
|---|---|
| Molecular weight | 271.88 g/mol |
| IUPAC name | 3-bromo-2,4-dichloro-5-nitropyridine |
| InChIKey | WQVDZYQKROCNIZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)Br)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)