CAS 856850-68-5 appears in our catalog under these names: 5-Bromo-2,4-dichloro-3-nitropyridine, 95%, 5-Bromo-2,4-dichloro-3-nitropyridine 98%, Pyridine, 5-bromo-2,4-dichloro-3-nitro-, 98%, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g, 25g, 500mg, 100g.
5-bromo-2,4-dichloro-3-nitropyridine (CAS 856850-68-5) is a chemical compound with the molecular formula C5HBrCl2N2O2 and a molecular weight of 271.88 g/mol. IUPAC name: 5-bromo-2,4-dichloro-3-nitropyridine. InChIKey: SMJWSYDXAHYIKL-UHFFFAOYSA-N.
| Molecular formula | C5HBrCl2N2O2 |
|---|---|
| Molecular weight | 271.88 g/mol |
| IUPAC name | 5-bromo-2,4-dichloro-3-nitropyridine |
| InChIKey | SMJWSYDXAHYIKL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)[N+](=O)[O-])Cl)Br |
Computed by PubChem (NCBI)