Products 850203-57-5

CAS 850203-57-5 is the registry number for (2-Amino-1,1-dimethyl-ethyl)-carbamic acid benzyl ester, 98%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Benzyl N-(1-amino-2-methylpropan-2-yl)carbamate (CAS 850203-57-5) is a chemical compound with the molecular formula C12H18N2O2 and a molecular weight of 222.28 g/mol. IUPAC name: benzyl N-(1-amino-2-methylpropan-2-yl)carbamate. InChIKey: HKVCDZMBQWFWAB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18N2O2
Molecular weight222.28 g/mol
IUPAC namebenzyl N-(1-amino-2-methylpropan-2-yl)carbamate
InChIKeyHKVCDZMBQWFWAB-UHFFFAOYSA-N
SMILESCC(C)(CN)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)