CAS 850340-83-9 appears in our catalog under these names: 5-Sulfamoylthiophene-2-carboxamide, 95%, 5-Sulfamoylthiophene-2-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
5-sulfamoylthiophene-2-carboxamide (CAS 850340-83-9) is a chemical compound with the molecular formula C5H6N2O3S2 and a molecular weight of 206.2 g/mol. IUPAC name: 5-sulfamoylthiophene-2-carboxamide. InChIKey: CESCDUQYTCBDKP-UHFFFAOYSA-N.
| Molecular formula | C5H6N2O3S2 |
|---|---|
| Molecular weight | 206.2 g/mol |
| IUPAC name | 5-sulfamoylthiophene-2-carboxamide |
| InChIKey | CESCDUQYTCBDKP-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)S(=O)(=O)N)C(=O)N |
Computed by PubChem (NCBI)