CAS 89066-62-6 is the registry number for 3-Sulfamoylthiophene-2-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-sulfamoylthiophene-2-carboxamide (CAS 89066-62-6) is a chemical compound with the molecular formula C5H6N2O3S2 and a molecular weight of 206.2 g/mol. IUPAC name: 3-sulfamoylthiophene-2-carboxamide. InChIKey: ZFWUSTBGGBUYIA-UHFFFAOYSA-N.
| Molecular formula | C5H6N2O3S2 |
|---|---|
| Molecular weight | 206.2 g/mol |
| IUPAC name | 3-sulfamoylthiophene-2-carboxamide |
| InChIKey | ZFWUSTBGGBUYIA-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1S(=O)(=O)N)C(=O)N |
Computed by PubChem (NCBI)