Products 850363-55-2
CAS 850363-55-2 is the registry number for 1-tert-Butyl 3-methyl 5-iodo-1H-indazole-1,3-dicarboxylate. Offered by: Biosynth. Available pack sizes: 1000mg.
1-O-tert-butyl 3-O-methyl 5-iodoindazole-1,3-dicarboxylate (CAS 850363-55-2) is a chemical compound with the molecular formula C14H15IN2O4 and a molecular weight of 402.18 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 5-iodoindazole-1,3-dicarboxylate. InChIKey: NAMYDZXMYKFFOK-UHFFFAOYSA-N.
| Molecular formula | C14H15IN2O4 |
|---|---|
| Molecular weight | 402.18 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 5-iodoindazole-1,3-dicarboxylate |
| InChIKey | NAMYDZXMYKFFOK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=C(C=C2)I)C(=N1)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
1-tert-Butyl 3-methyl 5-iodo-1H-indazole-1,3-dicarboxylate, 1-O-tert-butyl 3-O-methyl 5-iodoindazole-1,3-dicarboxylate, 1H-Indazole-1,3-dicarboxylic acid, 5-iodo-, 1-(1,1-dimethylethyl) 3-methyl ester, 1-tert-Butyl3-methyl5-iodo-1H-indazole-1,3-dicarboxylate, O1-tert-butyl O3-methyl 5-iodoindazole-1,3-dicarboxylate