Products 944904-57-8

CAS 944904-57-8 is the registry number for 1-(tert-Butyl) 5-methyl 3-iodo-1H-indazole-1,5-dicarboxylate, 97%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 5-O-methyl 3-iodoindazole-1,5-dicarboxylate (CAS 944904-57-8) is a chemical compound with the molecular formula C14H15IN2O4 and a molecular weight of 402.18 g/mol. IUPAC name: 1-O-tert-butyl 5-O-methyl 3-iodoindazole-1,5-dicarboxylate. InChIKey: GLKLIQCSYBOCII-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15IN2O4
Molecular weight402.18 g/mol
IUPAC name1-O-tert-butyl 5-O-methyl 3-iodoindazole-1,5-dicarboxylate
InChIKeyGLKLIQCSYBOCII-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C2=C(C=C(C=C2)C(=O)OC)C(=N1)I

Computed by PubChem (NCBI)