CAS 850429-70-8 is the registry number for N-t-Butyl 3-bromo-4-methylbenzenesulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 500g, 5g, 100g, 1g.
3-bromo-N-tert-butyl-4-methylbenzenesulfonamide (CAS 850429-70-8) is a chemical compound with the molecular formula C11H16BrNO2S and a molecular weight of 306.22 g/mol. IUPAC name: 3-bromo-N-tert-butyl-4-methylbenzenesulfonamide. InChIKey: GZGHIWXQPZQUHK-UHFFFAOYSA-N.
| Molecular formula | C11H16BrNO2S |
|---|---|
| Molecular weight | 306.22 g/mol |
| IUPAC name | 3-bromo-N-tert-butyl-4-methylbenzenesulfonamide |
| InChIKey | GZGHIWXQPZQUHK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)NC(C)(C)C)Br |
Computed by PubChem (NCBI)