CAS 850429-71-9 is the registry number for N,N-Diethyl 3-bromo-4-methylbenzenesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
3-bromo-N,N-diethyl-4-methylbenzenesulfonamide (CAS 850429-71-9) is a chemical compound with the molecular formula C11H16BrNO2S and a molecular weight of 306.22 g/mol. IUPAC name: 3-bromo-N,N-diethyl-4-methylbenzenesulfonamide. InChIKey: OGLQPDZZDCFKRG-UHFFFAOYSA-N.
| Molecular formula | C11H16BrNO2S |
|---|---|
| Molecular weight | 306.22 g/mol |
| IUPAC name | 3-bromo-N,N-diethyl-4-methylbenzenesulfonamide |
| InChIKey | OGLQPDZZDCFKRG-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC(=C(C=C1)C)Br |
Computed by PubChem (NCBI)