CAS 85051-67-8 is the registry number for 3,4,4-Trimethyl-1-phenylpent-1-yn-3-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,4,4-trimethyl-1-phenylpent-1-yn-3-ol (CAS 85051-67-8) is a chemical compound with the molecular formula C14H18O and a molecular weight of 202.29 g/mol. IUPAC name: 3,4,4-trimethyl-1-phenylpent-1-yn-3-ol. InChIKey: FNOTWYZKEJTYEO-UHFFFAOYSA-N.
| Molecular formula | C14H18O |
|---|---|
| Molecular weight | 202.29 g/mol |
| IUPAC name | 3,4,4-trimethyl-1-phenylpent-1-yn-3-ol |
| InChIKey | FNOTWYZKEJTYEO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C)(C#CC1=CC=CC=C1)O |
Computed by PubChem (NCBI)