CAS 850623-62-0 appears in our catalog under these names: Potassium (3-fluoro-4-methoxyphenyl)trifluoroborate, 95%, Potassium trifluoro(3-fluoro-4-methoxyphenyl)borate 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 25g, 100g, 1g, 5g, 250mg.
Potassium trifluoro-(3-fluoro-4-methoxyphenyl)boranuide (CAS 850623-62-0) is a chemical compound with the molecular formula C7H6BF4KO and a molecular weight of 232.03 g/mol. IUPAC name: potassium trifluoro-(3-fluoro-4-methoxyphenyl)boranuide. InChIKey: WQHFABRJAPVXCJ-UHFFFAOYSA-N.
| Molecular formula | C7H6BF4KO |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | potassium trifluoro-(3-fluoro-4-methoxyphenyl)boranuide |
| InChIKey | WQHFABRJAPVXCJ-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC(=C(C=C1)OC)F)(F)(F)F.[K+] |
Computed by PubChem (NCBI)