CAS 916178-96-6 is the registry number for Potassium trifluoro(2-fluoro-6-methoxyphenyl)boranuide, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 10g, 5g, 1g.
Potassium trifluoro-(2-fluoro-6-methoxyphenyl)boranuide (CAS 916178-96-6) is a chemical compound with the molecular formula C7H6BF4KO and a molecular weight of 232.03 g/mol. IUPAC name: potassium trifluoro-(2-fluoro-6-methoxyphenyl)boranuide. InChIKey: VXODINMXYDSUDC-UHFFFAOYSA-N.
| Molecular formula | C7H6BF4KO |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | potassium trifluoro-(2-fluoro-6-methoxyphenyl)boranuide |
| InChIKey | VXODINMXYDSUDC-UHFFFAOYSA-N |
| SMILES | [B-](C1=C(C=CC=C1F)OC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)