CAS 850623-68-6 is the registry number for Potassium (3,4-dichlorophenyl)trifluoroborate, 98%,RG, 98%,RG. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
Potassium (3,4-dichlorophenyl)-trifluoroboranuide (CAS 850623-68-6) is a chemical compound with the molecular formula C6H3BCl2F3K and a molecular weight of 252.90 g/mol. IUPAC name: potassium (3,4-dichlorophenyl)-trifluoroboranuide. InChIKey: RTZOKQYJVLRZFW-UHFFFAOYSA-N.
| Molecular formula | C6H3BCl2F3K |
|---|---|
| Molecular weight | 252.90 g/mol |
| IUPAC name | potassium (3,4-dichlorophenyl)-trifluoroboranuide |
| InChIKey | RTZOKQYJVLRZFW-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC(=C(C=C1)Cl)Cl)(F)(F)F.[K+] |
Computed by PubChem (NCBI)