CAS 929626-20-0 appears in our catalog under these names: Potassium (3,5–dichlorophenyl)trifluoroborate, Potassium (3,5-dichlorophenyl)trifluoroborate, 95+%, 95+%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g.
Potassium (3,5-dichlorophenyl)-trifluoroboranuide (CAS 929626-20-0) is a chemical compound with the molecular formula C6H3BCl2F3K and a molecular weight of 252.90 g/mol. IUPAC name: potassium (3,5-dichlorophenyl)-trifluoroboranuide. InChIKey: LPAWVDUPJPGETJ-UHFFFAOYSA-N.
| Molecular formula | C6H3BCl2F3K |
|---|---|
| Molecular weight | 252.90 g/mol |
| IUPAC name | potassium (3,5-dichlorophenyl)-trifluoroboranuide |
| InChIKey | LPAWVDUPJPGETJ-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC(=CC(=C1)Cl)Cl)(F)(F)F.[K+] |
Computed by PubChem (NCBI)