CAS 85068-34-4 is the registry number for 3',5'-Bis(trifluoromethyl)propiophenone, 98%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
1-[3,5-bis(trifluoromethyl)phenyl]propan-1-one (CAS 85068-34-4) is a chemical compound with the molecular formula C11H8F6O and a molecular weight of 270.17 g/mol. IUPAC name: 1-[3,5-bis(trifluoromethyl)phenyl]propan-1-one. InChIKey: VLRWCHKOSBUGMB-UHFFFAOYSA-N.
| Molecular formula | C11H8F6O |
|---|---|
| Molecular weight | 270.17 g/mol |
| IUPAC name | 1-[3,5-bis(trifluoromethyl)phenyl]propan-1-one |
| InChIKey | VLRWCHKOSBUGMB-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)