CAS 851000-46-9 appears in our catalog under these names: (R)-3-Phenylpyrrolidine hydrochloride, 97%, 97%, (R)-3-Phenyl-pyrrolidine hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(3R)-3-phenylpyrrolidine;hydrochloride (CAS 851000-46-9) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: (3R)-3-phenylpyrrolidine;hydrochloride. InChIKey: DNSSGEPIODMCQR-PPHPATTJSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | (3R)-3-phenylpyrrolidine;hydrochloride |
| InChIKey | DNSSGEPIODMCQR-PPHPATTJSA-N |
| SMILES | C1CNC[C@H]1C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)