CAS 85106-58-7 is the registry number for 4-Amino-5-(4-bromophenyl)-4h-1,2,4-triazole-3-thiol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-amino-3-(4-bromophenyl)-1H-1,2,4-triazole-5-thione (CAS 85106-58-7) is a chemical compound with the molecular formula C8H7BrN4S and a molecular weight of 271.14 g/mol. IUPAC name: 4-amino-3-(4-bromophenyl)-1H-1,2,4-triazole-5-thione. InChIKey: IGIGQDMDHXLNRL-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4S |
|---|---|
| Molecular weight | 271.14 g/mol |
| IUPAC name | 4-amino-3-(4-bromophenyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | IGIGQDMDHXLNRL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=S)N2N)Br |
Computed by PubChem (NCBI)