CAS 951970-16-4 is the registry number for 5-(5-Bromopyridin-3-yl)-4-methyl-4H-1,2,4-triazole-3-thiol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(5-bromo-3-pyridinyl)-4-methyl-1H-1,2,4-triazole-5-thione (CAS 951970-16-4) is a chemical compound with the molecular formula C8H7BrN4S and a molecular weight of 271.14 g/mol. IUPAC name: 3-(5-bromo-3-pyridinyl)-4-methyl-1H-1,2,4-triazole-5-thione. InChIKey: HYGXDHIAYXDXPI-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4S |
|---|---|
| Molecular weight | 271.14 g/mol |
| IUPAC name | 3-(5-bromo-3-pyridinyl)-4-methyl-1H-1,2,4-triazole-5-thione |
| InChIKey | HYGXDHIAYXDXPI-UHFFFAOYSA-N |
| SMILES | CN1C(=NNC1=S)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)