Products 851169-25-0
CAS 851169-25-0 is the registry number for 2-Cyano-N-(4-(2,5-dimethylphenyl)thiazol-2-yl)acetamide, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
2-cyano-N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]acetamide (CAS 851169-25-0) is a chemical compound with the molecular formula C14H13N3OS and a molecular weight of 271.34 g/mol. IUPAC name: 2-cyano-N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]acetamide. InChIKey: DFLIYVZMECVMIK-UHFFFAOYSA-N.
| Molecular formula | C14H13N3OS |
|---|---|
| Molecular weight | 271.34 g/mol |
| IUPAC name | 2-cyano-N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]acetamide |
| InChIKey | DFLIYVZMECVMIK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C2=CSC(=N2)NC(=O)CC#N |
Computed by PubChem (NCBI)