CAS 851169-29-4 is the registry number for 4-(4-Chlorophenyl)-3-(thiophen-2-yl)-2,5-dihydrofuran-2-one, 95%. Offered by: AmBeed. Available pack sizes: 10g.
3-(4-chlorophenyl)-4-thiophen-2-yl-2H-furan-5-one (CAS 851169-29-4) is a chemical compound with the molecular formula C14H9ClO2S and a molecular weight of 276.7 g/mol. IUPAC name: 3-(4-chlorophenyl)-4-thiophen-2-yl-2H-furan-5-one. InChIKey: DLJSREJYSFGHMC-UHFFFAOYSA-N.
| Molecular formula | C14H9ClO2S |
|---|---|
| Molecular weight | 276.7 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-4-thiophen-2-yl-2H-furan-5-one |
| InChIKey | DLJSREJYSFGHMC-UHFFFAOYSA-N |
| SMILES | C1C(=C(C(=O)O1)C2=CC=CS2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)