CAS 85992-30-9 is the registry number for Methyl 1-chloronaphtho[2,1-b]thiophene-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 1-chlorobenzo[e][1]benzothiole-2-carboxylate (CAS 85992-30-9) is a chemical compound with the molecular formula C14H9ClO2S and a molecular weight of 276.7 g/mol. IUPAC name: methyl 1-chlorobenzo[e][1]benzothiole-2-carboxylate. InChIKey: OHOGUWDSHRBKSE-UHFFFAOYSA-N.
| Molecular formula | C14H9ClO2S |
|---|---|
| Molecular weight | 276.7 g/mol |
| IUPAC name | methyl 1-chlorobenzo[e][1]benzothiole-2-carboxylate |
| InChIKey | OHOGUWDSHRBKSE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(S1)C=CC3=CC=CC=C32)Cl |
Computed by PubChem (NCBI)