Products 851307-40-9
CAS 851307-40-9 appears in our catalog under these names: (2R)-2-amino-3-(4-methoxyphenyl)-N-methyl-propanamide hydrochloride, 97%, 97%, (2R)-2-amino-3-(4-methoxyphenyl)-N-methyl-propanamide hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 5g, 1g.
(2R)-2-amino-3-(4-methoxyphenyl)-N-methylpropanamide;hydrochloride (CAS 851307-40-9) is a chemical compound with the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. IUPAC name: (2R)-2-amino-3-(4-methoxyphenyl)-N-methylpropanamide;hydrochloride. InChIKey: MNPPSMOMEYZRAW-HNCPQSOCSA-N.
| Molecular formula | C11H17ClN2O2 |
|---|---|
| Molecular weight | 244.72 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-methoxyphenyl)-N-methylpropanamide;hydrochloride |
| InChIKey | MNPPSMOMEYZRAW-HNCPQSOCSA-N |
| SMILES | CNC(=O)[C@@H](CC1=CC=C(C=C1)OC)N.Cl |
Computed by PubChem (NCBI)