Products 851340-73-3
CAS 851340-73-3 is the registry number for [1,1':4',1''-Terphenyl]-4,4''-bis(carboximidamide), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-(4-carbamimidoylphenyl)phenyl]benzenecarboximidamide (CAS 851340-73-3) is a chemical compound with the molecular formula C20H18N4 and a molecular weight of 314.4 g/mol. IUPAC name: 4-[4-(4-carbamimidoylphenyl)phenyl]benzenecarboximidamide. InChIKey: LFJMNKWLKNBHEE-UHFFFAOYSA-N.
| Molecular formula | C20H18N4 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 4-[4-(4-carbamimidoylphenyl)phenyl]benzenecarboximidamide |
| InChIKey | LFJMNKWLKNBHEE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C(=N)N)C3=CC=C(C=C3)C(=N)N |
Computed by PubChem (NCBI)