CAS 1789726-52-8 is the registry number for 4,4'-Bis(4-methyl-1H-imidazol-1-yl)-1,1'-biphenyl, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-1-[4-[4-(4-methylimidazol-1-yl)phenyl]phenyl]imidazole (CAS 1789726-52-8) is a chemical compound with the molecular formula C20H18N4 and a molecular weight of 314.4 g/mol. IUPAC name: 4-methyl-1-[4-[4-(4-methylimidazol-1-yl)phenyl]phenyl]imidazole. InChIKey: IWGHZRPEQIIOGR-UHFFFAOYSA-N.
| Molecular formula | C20H18N4 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 4-methyl-1-[4-[4-(4-methylimidazol-1-yl)phenyl]phenyl]imidazole |
| InChIKey | IWGHZRPEQIIOGR-UHFFFAOYSA-N |
| SMILES | CC1=CN(C=N1)C2=CC=C(C=C2)C3=CC=C(C=C3)N4C=C(N=C4)C |
Computed by PubChem (NCBI)