CAS 2757731-54-5 is the registry number for 4,4'-(1-Methyl-1H-benzo[d]imidazole-4,7-diyl)dianiline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[7-(4-aminophenyl)-1-methylbenzimidazol-4-yl]aniline (CAS 2757731-54-5) is a chemical compound with the molecular formula C20H18N4 and a molecular weight of 314.4 g/mol. IUPAC name: 4-[7-(4-aminophenyl)-1-methylbenzimidazol-4-yl]aniline. InChIKey: LGCNUXCTAPMISQ-UHFFFAOYSA-N.
| Molecular formula | C20H18N4 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 4-[7-(4-aminophenyl)-1-methylbenzimidazol-4-yl]aniline |
| InChIKey | LGCNUXCTAPMISQ-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C(C=CC(=C21)C3=CC=C(C=C3)N)C4=CC=C(C=C4)N |
Computed by PubChem (NCBI)