Products 851398-73-7

CAS 851398-73-7 is the registry number for 3-(3,4-Dimethylphenyl)-2-mercaptopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(3,4-dimethylphenyl)-2-sulfanylpropanoic acid (CAS 851398-73-7) is a chemical compound with the molecular formula C11H14O2S and a molecular weight of 210.29 g/mol. IUPAC name: 3-(3,4-dimethylphenyl)-2-sulfanylpropanoic acid. InChIKey: DOIJXPFLVOJSQW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O2S
Molecular weight210.29 g/mol
IUPAC name3-(3,4-dimethylphenyl)-2-sulfanylpropanoic acid
InChIKeyDOIJXPFLVOJSQW-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)CC(C(=O)O)S)C

Computed by PubChem (NCBI)