Products 85157-92-2
CAS 85157-92-2 is the registry number for 1-(4-Methoxyphenyl)-3,3-dimethylbutan-1-one, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-methoxyphenyl)-3,3-dimethylbutan-1-one (CAS 85157-92-2) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: 1-(4-methoxyphenyl)-3,3-dimethylbutan-1-one. InChIKey: VYMFZBJTEADJCT-UHFFFAOYSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-3,3-dimethylbutan-1-one |
| InChIKey | VYMFZBJTEADJCT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)