CAS 851973-26-7 appears in our catalog under these names: 4–CHLORO–6–FLUOROQUINOLINE–3–CARBOXAMIDE, 4-Chloro-6-fluoroquinoline-3-carboxamide 95%, 4-Chloro-6-fluoroquinoline-3-carboxamide, 95%, 95%, 4-Chloro-6-fluoroquinoline-3-carboxamide, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
4-chloro-6-fluoroquinoline-3-carboxamide (CAS 851973-26-7) is a chemical compound with the molecular formula C10H6ClFN2O and a molecular weight of 224.62 g/mol. IUPAC name: 4-chloro-6-fluoroquinoline-3-carboxamide. InChIKey: KGVDBWZRNKFOEY-UHFFFAOYSA-N.
| Molecular formula | C10H6ClFN2O |
|---|---|
| Molecular weight | 224.62 g/mol |
| IUPAC name | 4-chloro-6-fluoroquinoline-3-carboxamide |
| InChIKey | KGVDBWZRNKFOEY-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C(=C2C=C1F)Cl)C(=O)N |
Computed by PubChem (NCBI)