CAS 894416-95-6 is the registry number for 2-Chloro-6-(3-fluorophenoxy) pyrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-chloro-6-(3-fluorophenoxy)pyrazine (CAS 894416-95-6) is a chemical compound with the molecular formula C10H6ClFN2O and a molecular weight of 224.62 g/mol. IUPAC name: 2-chloro-6-(3-fluorophenoxy)pyrazine. InChIKey: FIMYUIDWIBADAZ-UHFFFAOYSA-N.
| Molecular formula | C10H6ClFN2O |
|---|---|
| Molecular weight | 224.62 g/mol |
| IUPAC name | 2-chloro-6-(3-fluorophenoxy)pyrazine |
| InChIKey | FIMYUIDWIBADAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)OC2=CN=CC(=N2)Cl |
Computed by PubChem (NCBI)