Products 851975-10-5

CAS 851975-10-5 appears in our catalog under these names: 2–Methyl–2–(1H–pyrazol–1–yl)propanoic acid, 2-Methyl-2-(1H-pyrazol-1-yl)propanoic acid, 2-Methyl-2-(1H-pyrazol-1-yl)propanoic acid 97%, α,α-Dimethyl-1H-pyrazole-1-acetic acid, 98%, 98%, 2-METHYL-2-(1H-PYRAZOL-1-YL)PROPANOIC ACID, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 1g, 5g, 100mg.

Structural formula: {0} (CAS {1})

2-methyl-2-pyrazol-1-ylpropanoic acid (CAS 851975-10-5) is a chemical compound with the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. IUPAC name: 2-methyl-2-pyrazol-1-ylpropanoic acid. InChIKey: SZGVDJHDIPSUSA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10N2O2
Molecular weight154.17 g/mol
IUPAC name2-methyl-2-pyrazol-1-ylpropanoic acid
InChIKeySZGVDJHDIPSUSA-UHFFFAOYSA-N
SMILESCC(C)(C(=O)O)N1C=CC=N1

Computed by PubChem (NCBI)