Products 852181-17-0
CAS 852181-17-0 appears in our catalog under these names: 3-(2-Fluoro-4-methylphenyl)propionic acid, 95%, 3-(2-Fluoro-4-methylphenyl)propionic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g.
3-(2-fluoro-4-methylphenyl)propanoic acid (CAS 852181-17-0) is a chemical compound with the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. IUPAC name: 3-(2-fluoro-4-methylphenyl)propanoic acid. InChIKey: HQOAGAGIHCHXLP-UHFFFAOYSA-N.
| Molecular formula | C10H11FO2 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 3-(2-fluoro-4-methylphenyl)propanoic acid |
| InChIKey | HQOAGAGIHCHXLP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)CCC(=O)O)F |
Computed by PubChem (NCBI)