Products 852218-14-5
CAS 852218-14-5 is the registry number for 1-Acetyl-4-phenylpiperidine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
1-acetyl-4-phenylpiperidine-4-carboxylic acid (CAS 852218-14-5) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: 1-acetyl-4-phenylpiperidine-4-carboxylic acid. InChIKey: KFZBKMCIJIEDGK-UHFFFAOYSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 1-acetyl-4-phenylpiperidine-4-carboxylic acid |
| InChIKey | KFZBKMCIJIEDGK-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC(CC1)(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)